C29H22F4N3PtS-3 — CID 58161779
[[2-[(2,4-difluorobenzene-6-id-1-yl)amino]-5-(2,2-dimethylpropyl)phenyl]-[[6-(2,4-difluorobenzene-6-id-1-yl)-2-pyridinyl]sulfanyl]methylidene]azanide;platinum (PubChem CID 58161779) has the molecular formula C29H22F4N3PtS-3 and a molecular weight of 715.65 g/mol. Its IUPAC name is [[2-[(2,4-difluorobenzene-6-id-1-yl)amino]-5-(2,2-dimethylpropyl)phenyl]-[[6-(2,4-difluorobenzene-6-id-1-yl)-2-pyridinyl]sulfanyl]methylidene]azanide;platinum.
| Compound Name | [[2-[(2,4-difluorobenzene-6-id-1-yl)amino]-5-(2,2-dimethylpropyl)phenyl]-[[6-(2,4-difluorobenzene-6-id-1-yl)-2-pyridinyl]sulfanyl]methylidene]azanide;platinum |
|---|---|
| PubChem CID | 58161779 |
| Molecular Formula | C29H22F4N3PtS-3 |
| Molecular Weight | 715.65 g/mol |
| Exact Mass | 715.11 |
| IUPAC Name | [[2-[(2,4-difluorobenzene-6-id-1-yl)amino]-5-(2,2-dimethylpropyl)phenyl]-[[6-(2,4-difluorobenzene-6-id-1-yl)-2-pyridinyl]sulfanyl]methylidene]azanide;platinum |
| SMILES | CC(C)(C)Cc1ccc(Nc2[c-]cc(F)cc2F)c(C(=[N-])Sc2cccc(-c3[c-]cc(F)cc3F)n2)c1.[Pt] |
| InChI | InChI=1S/C29H22F4N3S.Pt/c1-29(2,3)16-17-7-11-25(35-26-12-9-19(31)15-23(26)33)21(13-17)28(34)37-27-6-4-5-24(36-27)20-10-8-18(30)14-22(20)32;/h4-9,11,13-15,35H,16H2,1-3H3;/q-3; |
| InChIKey | KJKLUEDHVCBRFM-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 47.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.65 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|