C21H20N4O9S5 — CID 58163341
2-[[4-amino-2-methyl-5-(3-sulfopropylsulfanyl)phenyl]diazenyl]benzo[g][1,3]benzothiazole-4,8-disulfonic acid (PubChem CID 58163341) has the molecular formula C21H20N4O9S5 and a molecular weight of 632.75 g/mol. Its IUPAC name is 2-[[4-amino-2-methyl-5-(3-sulfopropylsulfanyl)phenyl]diazenyl]benzo[g][1,3]benzothiazole-4,8-disulfonic acid.
| Compound Name | 2-[[4-amino-2-methyl-5-(3-sulfopropylsulfanyl)phenyl]diazenyl]benzo[g][1,3]benzothiazole-4,8-disulfonic acid |
|---|---|
| PubChem CID | 58163341 |
| Molecular Formula | C21H20N4O9S5 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 631.98 |
| IUPAC Name | 2-[[4-amino-2-methyl-5-(3-sulfopropylsulfanyl)phenyl]diazenyl]benzo[g][1,3]benzothiazole-4,8-disulfonic acid |
| SMILES | Cc1cc(N)c(SCCCS(=O)(=O)O)cc1/N=N/c1nc2c(S(=O)(=O)O)cc3ccc(S(=O)(=O)O)cc3c2s1 |
| InChI | InChI=1S/C21H20N4O9S5/c1-11-7-15(22)17(35-5-2-6-37(26,27)28)10-16(11)24-25-21-23-19-18(39(32,33)34)8-12-3-4-13(38(29,30)31)9-14(12)20(19)36-21/h3-4,7-10H,2,5-6,22H2,1H3,(H,26,27,28)(H,29,30,31)(H,32,33,34)/b25-24+ |
| InChIKey | VBAUNUFGCXWNMC-OCOZRVBESA-N |
| XLogP | 4.62 |
| TPSA | 226.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|