C24H43NO — CID 58163586
(E)-17-[(1R)-cyclopent-2-en-1-yl]-1-(dimethylamino)heptadec-10-en-5-one (PubChem CID 58163586) has the molecular formula C24H43NO and a molecular weight of 361.61 g/mol. Its IUPAC name is (E)-17-[(1R)-cyclopent-2-en-1-yl]-1-(dimethylamino)heptadec-10-en-5-one.
| Compound Name | (E)-17-[(1R)-cyclopent-2-en-1-yl]-1-(dimethylamino)heptadec-10-en-5-one |
|---|---|
| PubChem CID | 58163586 |
| Molecular Formula | C24H43NO |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.33 |
| IUPAC Name | (E)-17-[(1R)-cyclopent-2-en-1-yl]-1-(dimethylamino)heptadec-10-en-5-one |
| SMILES | CN(C)CCCCC(=O)CCCC/C=C/CCCCCC[C@H]1C=CCC1 |
| InChI | InChI=1S/C24H43NO/c1-25(2)22-16-15-21-24(26)20-12-10-8-6-4-3-5-7-9-11-17-23-18-13-14-19-23/h4,6,13,18,23H,3,5,7-12,14-17,19-22H2,1-2H3/b6-4+/t23-/m0/s1 |
| InChIKey | AAVULILUKQHVTE-DOHLAZSCSA-N |
| XLogP | 6.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|