C24H22FN5O3 — CID 58164036
3-[6-(2-aminopyrimidin-4-yl)-4-fluoro-3H-indol-2-yl]-N-methoxy-N-methyl-3,4-dihydro-2H-chromene-6-carboxamide (PubChem CID 58164036) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is 3-[6-(2-aminopyrimidin-4-yl)-4-fluoro-3H-indol-2-yl]-N-methoxy-N-methyl-3,4-dihydro-2H-chromene-6-carboxamide.
| Compound Name | 3-[6-(2-aminopyrimidin-4-yl)-4-fluoro-3H-indol-2-yl]-N-methoxy-N-methyl-3,4-dihydro-2H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 58164036 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-[6-(2-aminopyrimidin-4-yl)-4-fluoro-3H-indol-2-yl]-N-methoxy-N-methyl-3,4-dihydro-2H-chromene-6-carboxamide |
| SMILES | CON(C)C(=O)c1ccc2c(c1)CC(C1=Nc3cc(-c4ccnc(N)n4)cc(F)c3C1)CO2 |
| InChI | InChI=1S/C24H22FN5O3/c1-30(32-2)23(31)13-3-4-22-15(7-13)8-16(12-33-22)20-11-17-18(25)9-14(10-21(17)28-20)19-5-6-27-24(26)29-19/h3-7,9-10,16H,8,11-12H2,1-2H3,(H2,26,27,29) |
| InChIKey | BWFDJTUWDAZASU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|