C13H16Cl4O8 — CID 58164580
2-chloro-2-[2-chloro-2-[2-chloro-2-(2-chloro-2-methylpropanoyl)oxypropanoyl]oxypropanoyl]oxypropanoic acid (PubChem CID 58164580) has the molecular formula C13H16Cl4O8 and a molecular weight of 442.08 g/mol. Its IUPAC name is 2-chloro-2-[2-chloro-2-[2-chloro-2-(2-chloro-2-methylpropanoyl)oxypropanoyl]oxypropanoyl]oxypropanoic acid.
| Compound Name | 2-chloro-2-[2-chloro-2-[2-chloro-2-(2-chloro-2-methylpropanoyl)oxypropanoyl]oxypropanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 58164580 |
| Molecular Formula | C13H16Cl4O8 |
| Molecular Weight | 442.08 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | 2-chloro-2-[2-chloro-2-[2-chloro-2-(2-chloro-2-methylpropanoyl)oxypropanoyl]oxypropanoyl]oxypropanoic acid |
| SMILES | CC(C)(Cl)C(=O)OC(C)(Cl)C(=O)OC(C)(Cl)C(=O)OC(C)(Cl)C(=O)O |
| InChI | InChI=1S/C13H16Cl4O8/c1-10(2,14)7(20)23-12(4,16)9(22)25-13(5,17)8(21)24-11(3,15)6(18)19/h1-5H3,(H,18,19) |
| InChIKey | KWUOHXGZBARTGE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.08 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|