C11H14Cl4O8 — CID 118921047
2-(1-carboxy-1-chloroethoxy)-2-[2-chloro-2-(1,1-dichloroethoxy)propanoyl]oxypropanoic acid (PubChem CID 118921047) has the molecular formula C11H14Cl4O8 and a molecular weight of 416.04 g/mol. Its IUPAC name is 2-(1-carboxy-1-chloroethoxy)-2-[2-chloro-2-(1,1-dichloroethoxy)propanoyl]oxypropanoic acid.
| Compound Name | 2-(1-carboxy-1-chloroethoxy)-2-[2-chloro-2-(1,1-dichloroethoxy)propanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 118921047 |
| Molecular Formula | C11H14Cl4O8 |
| Molecular Weight | 416.04 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 2-(1-carboxy-1-chloroethoxy)-2-[2-chloro-2-(1,1-dichloroethoxy)propanoyl]oxypropanoic acid |
| SMILES | CC(Cl)(Cl)OC(C)(Cl)C(=O)OC(C)(OC(C)(Cl)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H14Cl4O8/c1-8(12,5(16)17)22-10(3,6(18)19)21-7(20)9(2,13)23-11(4,14)15/h1-4H3,(H,16,17)(H,18,19) |
| InChIKey | SLRNXHIDSDNUMV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.04 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|