C20H20N3O8Y- — CID 58164976
[4-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]azanide;nitric acid;yttrium (PubChem CID 58164976) has the molecular formula C20H20N3O8Y- and a molecular weight of 519.30 g/mol. Its IUPAC name is [4-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]azanide;nitric acid;yttrium.
| Compound Name | [4-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]azanide;nitric acid;yttrium |
|---|---|
| PubChem CID | 58164976 |
| Molecular Formula | C20H20N3O8Y- |
| Molecular Weight | 519.30 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | [4-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]azanide;nitric acid;yttrium |
| SMILES | O=[N+]([O-])O.[NH-]C(=O)C(CCC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21.[Y] |
| InChI | InChI=1S/C20H20N2O5.HNO3.Y/c21-19(25)17(9-10-18(23)24)22-20(26)27-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16;2-1(3)4;/h1-8,16-17H,9-11H2,(H4,21,22,23,24,25,26);(H,2,3,4);/p-1 |
| InChIKey | ALKQIJWDYJUDIG-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|