C31H40N2OS — CID 58166020
9-[2-aminoethyl(methyl)amino]-1-tritylsulfanylnonan-4-one (PubChem CID 58166020) has the molecular formula C31H40N2OS and a molecular weight of 488.74 g/mol. Its IUPAC name is 9-[2-aminoethyl(methyl)amino]-1-tritylsulfanylnonan-4-one.
| Compound Name | 9-[2-aminoethyl(methyl)amino]-1-tritylsulfanylnonan-4-one |
|---|---|
| PubChem CID | 58166020 |
| Molecular Formula | C31H40N2OS |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 9-[2-aminoethyl(methyl)amino]-1-tritylsulfanylnonan-4-one |
| SMILES | CN(CCN)CCCCCC(=O)CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40N2OS/c1-33(25-23-32)24-13-5-12-21-30(34)22-14-26-35-31(27-15-6-2-7-16-27,28-17-8-3-9-18-28)29-19-10-4-11-20-29/h2-4,6-11,15-20H,5,12-14,21-26,32H2,1H3 |
| InChIKey | QFTDVCPDIRDKCZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|