C30H29FN4O5 — CID 58167812
5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-[4-(hydroxyamino)-4-oxobutyl]-1H-pyrrole-3-carboxamide (PubChem CID 58167812) has the molecular formula C30H29FN4O5 and a molecular weight of 544.58 g/mol. Its IUPAC name is 5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-[4-(hydroxyamino)-4-oxobutyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-[4-(hydroxyamino)-4-oxobutyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58167812 |
| Molecular Formula | C30H29FN4O5 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 5-[4-[4-[3-(2-fluoro-5-methylphenyl)-2-oxopropyl]phenoxy]-2-pyridinyl]-N-[4-(hydroxyamino)-4-oxobutyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1ccc(F)c(CC(=O)Cc2ccc(Oc3ccnc(-c4cc(C(=O)NCCCC(=O)NO)c[nH]4)c3)cc2)c1 |
| InChI | InChI=1S/C30H29FN4O5/c1-19-4-9-26(31)21(13-19)15-23(36)14-20-5-7-24(8-6-20)40-25-10-12-32-28(17-25)27-16-22(18-34-27)30(38)33-11-2-3-29(37)35-39/h4-10,12-13,16-18,34,39H,2-3,11,14-15H2,1H3,(H,33,38)(H,35,37) |
| InChIKey | VTTLLGGKVZULHC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|