C19H19N5O2S — CID 58169183
1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]propane-1,3-diol (PubChem CID 58169183) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]propane-1,3-diol.
| Compound Name | 1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 58169183 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-[5-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]-5-ethynylpyrimidin-2-yl]thiophen-2-yl]propane-1,3-diol |
| SMILES | C#Cc1cnc(-c2ccc(C(O)CCO)s2)nc1Nc1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C19H19N5O2S/c1-2-11-10-20-19(16-6-5-15(27-16)14(26)7-8-25)22-18(11)21-17-9-13(23-24-17)12-3-4-12/h1,5-6,9-10,12,14,25-26H,3-4,7-8H2,(H2,20,21,22,23,24) |
| InChIKey | CPIVFUSHYYKWTR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|