About N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide
N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide (PubChem CID 58170987) has the molecular formula C15H20Cl2N2O
and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide.
Molecular Properties
| Compound Name | N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide |
| PubChem CID | 58170987 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide |
| SMILES | CCC(=O)NCCc1cc(Cl)c(Cl)c(CNC2CC2)c1 |
| InChI | InChI=1S/C15H20Cl2N2O/c1-2-14(20)18-6-5-10-7-11(9-19-12-3-4-12)15(17)13(16)8-10/h7-8,12,19H,2-6,9H2,1H3,(H,18,20) |
| InChIKey | VVLFAUANEHDANX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide?
The IUPAC name of N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide (CID 58170987) is N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide.
What is the SMILES notation for N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide?
The canonical SMILES for N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide is CCC(=O)NCCc1cc(Cl)c(Cl)c(CNC2CC2)c1.
What is the InChIKey of N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide?
The InChIKey is VVLFAUANEHDANX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N2O/c1-2-14(20)18-6-5-10-7-11(9-19-12-3-4-12)15(17)13(16)8-10/h7-8,12,19H,2-6,9H2,1H3,(H,18,20).
What are the key properties of N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide?
N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide has a molecular weight of 315.24 g/mol, XLogP of 3.31, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3,4-dichloro-5-[(cyclopropylamino)methyl]phenyl]ethyl]propanamide is sourced from PubChem (CID 58170987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).