C15H22Cl2N2O — CID 3039074
N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide (PubChem CID 3039074) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 3039074 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)propyl]-2-(diethylamino)acetamide |
| SMILES | CCC(NC(=O)CN(CC)CC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-4-14(11-7-8-12(16)13(17)9-11)18-15(20)10-19(5-2)6-3/h7-9,14H,4-6,10H2,1-3H3,(H,18,20) |
| InChIKey | BYEXFDAOAUMJMV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |