C26H26N4O3 — CID 58173036
N-[3-[[3-[4-(3-hydroxypropyl)triazol-1-yl]phenyl]methyl]phenyl]-4-methoxybenzamide (PubChem CID 58173036) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[3-[[3-[4-(3-hydroxypropyl)triazol-1-yl]phenyl]methyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[3-[[3-[4-(3-hydroxypropyl)triazol-1-yl]phenyl]methyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 58173036 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[3-[[3-[4-(3-hydroxypropyl)triazol-1-yl]phenyl]methyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(Cc3cccc(-n4cc(CCCO)nn4)c3)c2)cc1 |
| InChI | InChI=1S/C26H26N4O3/c1-33-25-12-10-21(11-13-25)26(32)27-22-7-2-5-19(16-22)15-20-6-3-9-24(17-20)30-18-23(28-29-30)8-4-14-31/h2-3,5-7,9-13,16-18,31H,4,8,14-15H2,1H3,(H,27,32) |
| InChIKey | BFGYFWPKCRNBRZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |