C18H12FN3O2PdS — CID 58174325
benzo[h]quinolin-10-yl(pyridin-2-ylsulfonyl)azanide;fluoropalladium(1+) (PubChem CID 58174325) has the molecular formula C18H12FN3O2PdS and a molecular weight of 459.80 g/mol. Its IUPAC name is benzo[h]quinolin-10-yl(pyridin-2-ylsulfonyl)azanide;fluoropalladium(1+).
| Compound Name | benzo[h]quinolin-10-yl(pyridin-2-ylsulfonyl)azanide;fluoropalladium(1+) |
|---|---|
| PubChem CID | 58174325 |
| Molecular Formula | C18H12FN3O2PdS |
| Molecular Weight | 459.80 g/mol |
| Exact Mass | 458.97 |
| IUPAC Name | benzo[h]quinolin-10-yl(pyridin-2-ylsulfonyl)azanide;fluoropalladium(1+) |
| SMILES | F[Pd+].O=S(=O)([N-]c1cccc2ccc3cccnc3c12)c1ccccn1 |
| InChI | InChI=1S/C18H12N3O2S.FH.Pd/c22-24(23,16-8-1-2-11-19-16)21-15-7-3-5-13-9-10-14-6-4-12-20-18(14)17(13)15;;/h1-12H;1H;/q-1;;+2/p-1 |
| InChIKey | GHYAJZFDODOOHR-UHFFFAOYSA-M |
| XLogP | 4.59 |
| TPSA | 74.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.80 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|