About fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine
fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine (PubChem CID 58174390) has the molecular formula C22H17FN4O4PdS
and a molecular weight of 558.89 g/mol. Its IUPAC name is fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine.
Molecular Properties
| Compound Name | fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine |
| PubChem CID | 58174390 |
| Molecular Formula | C22H17FN4O4PdS |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.00 |
| IUPAC Name | fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine |
| SMILES | F[Pd+].O=[N+]([O-])c1ccccc1S(=O)(=O)[N-]c1ccccc1-c1ccccn1.c1ccncc1 |
| InChI | InChI=1S/C17H12N3O4S.C5H5N.FH.Pd/c21-20(22)16-10-3-4-11-17(16)25(23,24)19-15-9-2-1-7-13(15)14-8-5-6-12-18-14;1-2-4-6-5-3-1;;/h1-12H;1-5H;1H;/q-1;;;+2/p-1 |
| InChIKey | FLSHUTWPXZRDLU-UHFFFAOYSA-M |
| XLogP | 5.55 |
| TPSA | 117.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
The IUPAC name of fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine (CID 58174390) is fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine.
What is the SMILES notation for fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
The canonical SMILES for fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine is F[Pd+].O=[N+]([O-])c1ccccc1S(=O)(=O)[N-]c1ccccc1-c1ccccn1.c1ccncc1.
What is the InChIKey of fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
The InChIKey is FLSHUTWPXZRDLU-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H12N3O4S.C5H5N.FH.Pd/c21-20(22)16-10-3-4-11-17(16)25(23,24)19-15-9-2-1-7-13(15)14-8-5-6-12-18-14;1-2-4-6-5-3-1;;/h1-12H;1-5H;1H;/q-1;;;+2/p-1.
What are the key properties of fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine?
fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine has a molecular weight of 558.89 g/mol, XLogP of 5.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoropalladium(1+);(2-nitrophenyl)sulfonyl-(2-pyridin-2-ylphenyl)azanide;pyridine is sourced from PubChem (CID 58174390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).