C23H16F5N3O2PdS — CID 58174392
fluoropalladium(1+);pyridine;(2-pyridin-2-ylphenyl)-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylazanide (PubChem CID 58174392) has the molecular formula C23H16F5N3O2PdS and a molecular weight of 599.88 g/mol. Its IUPAC name is fluoropalladium(1+);pyridine;(2-pyridin-2-ylphenyl)-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylazanide.
| Compound Name | fluoropalladium(1+);pyridine;(2-pyridin-2-ylphenyl)-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 58174392 |
| Molecular Formula | C23H16F5N3O2PdS |
| Molecular Weight | 599.88 g/mol |
| Exact Mass | 598.99 |
| IUPAC Name | fluoropalladium(1+);pyridine;(2-pyridin-2-ylphenyl)-(2,3,4,6-tetrafluoro-5-methylphenyl)sulfonylazanide |
| SMILES | Cc1c(F)c(F)c(F)c(S(=O)(=O)[N-]c2ccccc2-c2ccccn2)c1F.F[Pd+].c1ccncc1 |
| InChI | InChI=1S/C18H11F4N2O2S.C5H5N.FH.Pd/c1-10-14(19)16(21)17(22)18(15(10)20)27(25,26)24-13-8-3-2-6-11(13)12-7-4-5-9-23-12;1-2-4-6-5-3-1;;/h2-9H,1H3;1-5H;1H;/q-1;;;+2/p-1 |
| InChIKey | SJSNQULFDRUJAI-UHFFFAOYSA-M |
| XLogP | 6.51 |
| TPSA | 74.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.88 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|