C8H11N3O2SWY-2 — CID 58176091
[(6S)-3-azanidylcarbonyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]azanide;tungsten;yttrium (PubChem CID 58176091) has the molecular formula C8H11N3O2SWY-2 and a molecular weight of 486.01 g/mol. Its IUPAC name is [(6S)-3-azanidylcarbonyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]azanide;tungsten;yttrium.
| Compound Name | [(6S)-3-azanidylcarbonyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]azanide;tungsten;yttrium |
|---|---|
| PubChem CID | 58176091 |
| Molecular Formula | C8H11N3O2SWY-2 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | [(6S)-3-azanidylcarbonyl-5-oxo-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-6-yl]azanide;tungsten;yttrium |
| SMILES | [NH-]C(=O)C1CSC2CC[C@H]([NH-])C(=O)N21.[W].[Y] |
| InChI | InChI=1S/C8H12N3O2S.W.Y/c9-4-1-2-6-11(8(4)13)5(3-14-6)7(10)12;;/h4-6,9H,1-3H2,(H2,10,12);;/q-1;;/p-1/t4-,5?,6?;;/m0../s1 |
| InChIKey | HENMBAMLKJRNFL-DWZDZCSXSA-M |
| XLogP | 1.04 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |