C9H13F3N2OS — CID 143168361
(3R,6S,8aS)-6-(methylamino)-3-(trifluoromethyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one (PubChem CID 143168361) has the molecular formula C9H13F3N2OS and a molecular weight of 254.28 g/mol. Its IUPAC name is (3R,6S,8aS)-6-(methylamino)-3-(trifluoromethyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,6S,8aS)-6-(methylamino)-3-(trifluoromethyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 143168361 |
| Molecular Formula | C9H13F3N2OS |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (3R,6S,8aS)-6-(methylamino)-3-(trifluoromethyl)-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
| SMILES | CN[C@H]1CC[C@@H]2SC[C@@H](C(F)(F)F)N2C1=O |
| InChI | InChI=1S/C9H13F3N2OS/c1-13-5-2-3-7-14(8(5)15)6(4-16-7)9(10,11)12/h5-7,13H,2-4H2,1H3/t5-,6-,7-/m0/s1 |
| InChIKey | SEBFJZHDUIINQV-ACZMJKKPSA-N |
| XLogP | 1.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |