C11H17F3N2OS — CID 166494915
3,3-dimethyl-6-(2,2,2-trifluoroethylamino)-6,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyridin-5-one (PubChem CID 166494915) has the molecular formula C11H17F3N2OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 3,3-dimethyl-6-(2,2,2-trifluoroethylamino)-6,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyridin-5-one.
| Compound Name | 3,3-dimethyl-6-(2,2,2-trifluoroethylamino)-6,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 166494915 |
| Molecular Formula | C11H17F3N2OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3,3-dimethyl-6-(2,2,2-trifluoroethylamino)-6,7,8,8a-tetrahydro-2H-[1,3]thiazolo[3,2-a]pyridin-5-one |
| SMILES | CC1(C)CSC2CCC(NCC(F)(F)F)C(=O)N21 |
| InChI | InChI=1S/C11H17F3N2OS/c1-10(2)6-18-8-4-3-7(9(17)16(8)10)15-5-11(12,13)14/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | HETSODUZULYGEI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |