C19H19F2N7 — CID 58179717
5-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-[1-(2,3-difluorophenyl)tetrazol-5-yl]pyridin-2-amine (PubChem CID 58179717) has the molecular formula C19H19F2N7 and a molecular weight of 383.41 g/mol. Its IUPAC name is 5-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-[1-(2,3-difluorophenyl)tetrazol-5-yl]pyridin-2-amine.
| Compound Name | 5-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-[1-(2,3-difluorophenyl)tetrazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58179717 |
| Molecular Formula | C19H19F2N7 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 5-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-[1-(2,3-difluorophenyl)tetrazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ncc(C2C[C@H]3CNC[C@H]3C2)cc1-c1nnnn1-c1cccc(F)c1F |
| InChI | InChI=1S/C19H19F2N7/c20-15-2-1-3-16(17(15)21)28-19(25-26-27-28)14-6-13(9-24-18(14)22)10-4-11-7-23-8-12(11)5-10/h1-3,6,9-12,23H,4-5,7-8H2,(H2,22,24)/t10?,11-,12+ |
| InChIKey | KEDWYXLYAPROMG-YOGCLGLASA-N |
| XLogP | 2.30 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |