C21H18ClF2N7 — CID 58180152
3-[1-(2-chloro-3,5-difluorophenyl)tetrazol-5-yl]-5-[4-[(dimethylamino)methyl]phenyl]pyridin-2-amine (PubChem CID 58180152) has the molecular formula C21H18ClF2N7 and a molecular weight of 441.87 g/mol. Its IUPAC name is 3-[1-(2-chloro-3,5-difluorophenyl)tetrazol-5-yl]-5-[4-[(dimethylamino)methyl]phenyl]pyridin-2-amine.
| Compound Name | 3-[1-(2-chloro-3,5-difluorophenyl)tetrazol-5-yl]-5-[4-[(dimethylamino)methyl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 58180152 |
| Molecular Formula | C21H18ClF2N7 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 3-[1-(2-chloro-3,5-difluorophenyl)tetrazol-5-yl]-5-[4-[(dimethylamino)methyl]phenyl]pyridin-2-amine |
| SMILES | CN(C)Cc1ccc(-c2cnc(N)c(-c3nnnn3-c3cc(F)cc(F)c3Cl)c2)cc1 |
| InChI | InChI=1S/C21H18ClF2N7/c1-30(2)11-12-3-5-13(6-4-12)14-7-16(20(25)26-10-14)21-27-28-29-31(21)18-9-15(23)8-17(24)19(18)22/h3-10H,11H2,1-2H3,(H2,25,26) |
| InChIKey | RBDVSTPYRGASEL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|