C21H18F3N7 — CID 58179700
5-[4-[(dimethylamino)methyl]phenyl]-3-[1-(2,3,6-trifluorophenyl)tetrazol-5-yl]pyridin-2-amine (PubChem CID 58179700) has the molecular formula C21H18F3N7 and a molecular weight of 425.42 g/mol. Its IUPAC name is 5-[4-[(dimethylamino)methyl]phenyl]-3-[1-(2,3,6-trifluorophenyl)tetrazol-5-yl]pyridin-2-amine.
| Compound Name | 5-[4-[(dimethylamino)methyl]phenyl]-3-[1-(2,3,6-trifluorophenyl)tetrazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58179700 |
| Molecular Formula | C21H18F3N7 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 5-[4-[(dimethylamino)methyl]phenyl]-3-[1-(2,3,6-trifluorophenyl)tetrazol-5-yl]pyridin-2-amine |
| SMILES | CN(C)Cc1ccc(-c2cnc(N)c(-c3nnnn3-c3c(F)ccc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C21H18F3N7/c1-30(2)11-12-3-5-13(6-4-12)14-9-15(20(25)26-10-14)21-27-28-29-31(21)19-17(23)8-7-16(22)18(19)24/h3-10H,11H2,1-2H3,(H2,25,26) |
| InChIKey | IBDJIOVXJAWSCQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|