C24H25F2N7O — CID 143548758
1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]anilino]-3,3-dimethylbutan-1-ol (PubChem CID 143548758) has the molecular formula C24H25F2N7O and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]anilino]-3,3-dimethylbutan-1-ol.
| Compound Name | 1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]anilino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 143548758 |
| Molecular Formula | C24H25F2N7O |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]anilino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(C)CC(O)Nc1ccc(-c2cnc(N)c(-c3nnnn3-c3cccc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C24H25F2N7O/c1-24(2,3)12-20(34)29-16-9-7-14(8-10-16)15-11-17(22(27)28-13-15)23-30-31-32-33(23)19-6-4-5-18(25)21(19)26/h4-11,13,20,29,34H,12H2,1-3H3,(H2,27,28) |
| InChIKey | MZVCPIUBXNUOLD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|