C22H19F2N7O3 — CID 58179951
2-methoxyethyl N-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]carbamate (PubChem CID 58179951) has the molecular formula C22H19F2N7O3 and a molecular weight of 467.44 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]carbamate |
|---|---|
| PubChem CID | 58179951 |
| Molecular Formula | C22H19F2N7O3 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-methoxyethyl N-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1ccc(-c2cnc(N)c(-c3nnnn3-c3cccc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C22H19F2N7O3/c1-33-9-10-34-22(32)27-15-7-5-13(6-8-15)14-11-16(20(25)26-12-14)21-28-29-30-31(21)18-4-2-3-17(23)19(18)24/h2-8,11-12H,9-10H2,1H3,(H2,25,26)(H,27,32) |
| InChIKey | CSIHBTBWNBTORG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|