C27H22F2N6O4 — CID 159743929
1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 159743929) has the molecular formula C27H22F2N6O4 and a molecular weight of 532.51 g/mol. Its IUPAC name is 1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 159743929 |
| Molecular Formula | C27H22F2N6O4 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 1-[4-[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl]phenyl]-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CCC(C(=O)O)(c2ccc(-c3cnc(N)c(-c4nnnn4-c4cccc(F)c4F)c3)cc2)C1 |
| InChI | InChI=1S/C27H22F2N6O4/c1-26(24(36)37)10-3-11-27(14-26,25(38)39)17-8-6-15(7-9-17)16-12-18(22(30)31-13-16)23-32-33-34-35(23)20-5-2-4-19(28)21(20)29/h2-10,12-13H,11,14H2,1H3,(H2,30,31)(H,36,37)(H,38,39) |
| InChIKey | ZAXJMDDDBMOBPO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 157.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|