C25H29N5O2 — CID 58180657
5-(3-amino-2-methylphenyl)-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one (PubChem CID 58180657) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 5-(3-amino-2-methylphenyl)-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one.
| Compound Name | 5-(3-amino-2-methylphenyl)-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 58180657 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 5-(3-amino-2-methylphenyl)-3-[[4-(1,4-dimethyl-3-oxopiperazin-2-yl)phenyl]methyl]-1-methylpyrazin-2-one |
| SMILES | Cc1c(N)cccc1-c1cn(C)c(=O)c(Cc2ccc(C3C(=O)N(C)CCN3C)cc2)n1 |
| InChI | InChI=1S/C25H29N5O2/c1-16-19(6-5-7-20(16)26)22-15-30(4)24(31)21(27-22)14-17-8-10-18(11-9-17)23-25(32)29(3)13-12-28(23)2/h5-11,15,23H,12-14,26H2,1-4H3 |
| InChIKey | RVJOKPHYKIHAPQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|