C22H17F4N3O5 — CID 58181728
[(1R)-2-(3-fluoro-4-isocyanoanilino)-2-oxo-1-[(2R)-3-oxo-4-[4-(trifluoromethyl)phenyl]morpholin-2-yl]ethyl] acetate (PubChem CID 58181728) has the molecular formula C22H17F4N3O5 and a molecular weight of 479.39 g/mol. Its IUPAC name is [(1R)-2-(3-fluoro-4-isocyanoanilino)-2-oxo-1-[(2R)-3-oxo-4-[4-(trifluoromethyl)phenyl]morpholin-2-yl]ethyl] acetate.
| Compound Name | [(1R)-2-(3-fluoro-4-isocyanoanilino)-2-oxo-1-[(2R)-3-oxo-4-[4-(trifluoromethyl)phenyl]morpholin-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 58181728 |
| Molecular Formula | C22H17F4N3O5 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | [(1R)-2-(3-fluoro-4-isocyanoanilino)-2-oxo-1-[(2R)-3-oxo-4-[4-(trifluoromethyl)phenyl]morpholin-2-yl]ethyl] acetate |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@H](OC(C)=O)[C@H]2OCCN(c3ccc(C(F)(F)F)cc3)C2=O)cc1F |
| InChI | InChI=1S/C22H17F4N3O5/c1-12(30)34-18(20(31)28-14-5-8-17(27-2)16(23)11-14)19-21(32)29(9-10-33-19)15-6-3-13(4-7-15)22(24,25)26/h3-8,11,18-19H,9-10H2,1H3,(H,28,31)/t18-,19-/m1/s1 |
| InChIKey | SJYZCVAKFOSCOK-RTBURBONSA-N |
| XLogP | 3.70 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|