About tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate
tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate (PubChem CID 87243623) has the molecular formula C20H21F6NO6
and a molecular weight of 485.38 g/mol. Its IUPAC name is tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate |
| PubChem CID | 87243623 |
| Molecular Formula | C20H21F6NO6 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate |
| SMILES | CC(=O)OC(C(=O)OC(C)(C)C)[C@H]1OCCN(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C20H21F6NO6/c1-10(28)32-15(17(30)33-18(2,3)4)14-16(29)27(5-6-31-14)13-8-11(19(21,22)23)7-12(9-13)20(24,25)26/h7-9,14-15H,5-6H2,1-4H3/t14-,15?/m1/s1 |
| InChIKey | PILUXMIPTOOZKO-GICMACPYSA-N |
| XLogP | 3.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate?
The IUPAC name of tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate (CID 87243623) is tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate.
What is the SMILES notation for tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate?
The canonical SMILES for tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate is CC(=O)OC(C(=O)OC(C)(C)C)[C@H]1OCCN(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O.
What is the InChIKey of tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate?
The InChIKey is PILUXMIPTOOZKO-GICMACPYSA-N. The full InChI is InChI=1S/C20H21F6NO6/c1-10(28)32-15(17(30)33-18(2,3)4)14-16(29)27(5-6-31-14)13-8-11(19(21,22)23)7-12(9-13)20(24,25)26/h7-9,14-15H,5-6H2,1-4H3/t14-,15?/m1/s1.
What are the key properties of tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate?
tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate has a molecular weight of 485.38 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-acetyloxy-2-[(2R)-4-[3,5-bis(trifluoromethyl)phenyl]-3-oxomorpholin-2-yl]acetate is sourced from PubChem (CID 87243623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).