C17H20F2N2O6 — CID 58181967
tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(5,6-difluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate (PubChem CID 58181967) has the molecular formula C17H20F2N2O6 and a molecular weight of 386.35 g/mol. Its IUPAC name is tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(5,6-difluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate.
| Compound Name | tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(5,6-difluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate |
|---|---|
| PubChem CID | 58181967 |
| Molecular Formula | C17H20F2N2O6 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(5,6-difluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate |
| SMILES | CC(=O)O[C@@H](C(=O)OC(C)(C)C)[C@H]1OCCN(c2cnc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C17H20F2N2O6/c1-9(22)26-13(16(24)27-17(2,3)4)12-15(23)21(5-6-25-12)10-7-11(18)14(19)20-8-10/h7-8,12-13H,5-6H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | CMDRFSREVPJRLE-CHWSQXEVSA-N |
| XLogP | 1.37 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|