C17H21FN2O6 — CID 58181614
tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(6-fluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate (PubChem CID 58181614) has the molecular formula C17H21FN2O6 and a molecular weight of 368.36 g/mol. Its IUPAC name is tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(6-fluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate.
| Compound Name | tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(6-fluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate |
|---|---|
| PubChem CID | 58181614 |
| Molecular Formula | C17H21FN2O6 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | tert-butyl (2R)-2-acetyloxy-2-[(2R)-4-(6-fluoro-3-pyridinyl)-3-oxomorpholin-2-yl]acetate |
| SMILES | CC(=O)O[C@@H](C(=O)OC(C)(C)C)[C@H]1OCCN(c2ccc(F)nc2)C1=O |
| InChI | InChI=1S/C17H21FN2O6/c1-10(21)25-14(16(23)26-17(2,3)4)13-15(22)20(7-8-24-13)11-5-6-12(18)19-9-11/h5-6,9,13-14H,7-8H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | XSMZLEMSCWGEBD-ZIAGYGMSSA-N |
| XLogP | 1.23 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|