C7H14O2S — CID 58183534
8-methyl-1,4-oxathiocan-3-ol (PubChem CID 58183534) has the molecular formula C7H14O2S and a molecular weight of 162.25 g/mol. Its IUPAC name is 8-methyl-1,4-oxathiocan-3-ol.
| Compound Name | 8-methyl-1,4-oxathiocan-3-ol |
|---|---|
| PubChem CID | 58183534 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 8-methyl-1,4-oxathiocan-3-ol |
| SMILES | CC1CCCSC(O)CO1 |
| InChI | InChI=1S/C7H14O2S/c1-6-3-2-4-10-7(8)5-9-6/h6-8H,2-5H2,1H3 |
| InChIKey | MGSFLGLEAZOLPR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |