C14H14F3NO3 — CID 58187480
7-methylidene-4-(5,5,5-trifluoropentyl)-8H-pyrano[3,2-c]pyridine-2,5-dione (PubChem CID 58187480) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 7-methylidene-4-(5,5,5-trifluoropentyl)-8H-pyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 7-methylidene-4-(5,5,5-trifluoropentyl)-8H-pyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 58187480 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 7-methylidene-4-(5,5,5-trifluoropentyl)-8H-pyrano[3,2-c]pyridine-2,5-dione |
| SMILES | C=C1Cc2oc(=O)cc(CCCCC(F)(F)F)c2C(=O)N1 |
| InChI | InChI=1S/C14H14F3NO3/c1-8-6-10-12(13(20)18-8)9(7-11(19)21-10)4-2-3-5-14(15,16)17/h7H,1-6H2,(H,18,20) |
| InChIKey | VNGHSQRTXUCXKJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|