C12H10F3NO4 — CID 58317102
4-(4,4,4-trifluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317102) has the molecular formula C12H10F3NO4 and a molecular weight of 289.21 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-(4,4,4-trifluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317102 |
| Molecular Formula | C12H10F3NO4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-(4,4,4-trifluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(CCCC(F)(F)F)c2C(=O)N1 |
| InChI | InChI=1S/C12H10F3NO4/c13-12(14,15)3-1-2-6-4-9(18)20-7-5-8(17)16-11(19)10(6)7/h4H,1-3,5H2,(H,16,17,19) |
| InChIKey | OUYBCEUWDHJXPF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|