C15H19NO3 — CID 58187698
4-hexyl-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione (PubChem CID 58187698) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-hexyl-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 4-hexyl-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 58187698 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-hexyl-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione |
| SMILES | C=C1Cc2oc(=O)cc(CCCCCC)c2C(=O)N1 |
| InChI | InChI=1S/C15H19NO3/c1-3-4-5-6-7-11-9-13(17)19-12-8-10(2)16-15(18)14(11)12/h9H,2-8H2,1H3,(H,16,18) |
| InChIKey | BAWIHJDEWHHQFR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|