C16H21N3 — CID 58189332
15-methyl-8,11,18-triazatetracyclo[9.7.0.03,8.012,17]octadeca-1(18),12(17),13,15-tetraene (PubChem CID 58189332) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 15-methyl-8,11,18-triazatetracyclo[9.7.0.03,8.012,17]octadeca-1(18),12(17),13,15-tetraene.
| Compound Name | 15-methyl-8,11,18-triazatetracyclo[9.7.0.03,8.012,17]octadeca-1(18),12(17),13,15-tetraene |
|---|---|
| PubChem CID | 58189332 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 15-methyl-8,11,18-triazatetracyclo[9.7.0.03,8.012,17]octadeca-1(18),12(17),13,15-tetraene |
| SMILES | Cc1ccc2c(c1)nc1n2CCN2CCCCC2C1 |
| InChI | InChI=1S/C16H21N3/c1-12-5-6-15-14(10-12)17-16-11-13-4-2-3-7-18(13)8-9-19(15)16/h5-6,10,13H,2-4,7-9,11H2,1H3 |
| InChIKey | XVDTVIQKXTZDIK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |