C29H33F2N3O2 — CID 58190152
4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one (PubChem CID 58190152) has the molecular formula C29H33F2N3O2 and a molecular weight of 493.60 g/mol. Its IUPAC name is 4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one.
| Compound Name | 4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one |
|---|---|
| PubChem CID | 58190152 |
| Molecular Formula | C29H33F2N3O2 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one |
| SMILES | CN1CCN(CCCOc2cc(F)cc(CCC(=O)Cc3ccc(-c4ccc(F)cc4)cn3)c2)CC1 |
| InChI | InChI=1S/C29H33F2N3O2/c1-33-12-14-34(15-13-33)11-2-16-36-29-18-22(17-26(31)19-29)3-10-28(35)20-27-9-6-24(21-32-27)23-4-7-25(30)8-5-23/h4-9,17-19,21H,2-3,10-16,20H2,1H3 |
| InChIKey | MDNBKNNJXXDVTC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|