C28H31FN2O3 — CID 58190170
4-(3-fluorophenyl)-1-[5-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-pyridinyl]butan-2-one (PubChem CID 58190170) has the molecular formula C28H31FN2O3 and a molecular weight of 462.57 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1-[5-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-pyridinyl]butan-2-one.
| Compound Name | 4-(3-fluorophenyl)-1-[5-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-pyridinyl]butan-2-one |
|---|---|
| PubChem CID | 58190170 |
| Molecular Formula | C28H31FN2O3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 4-(3-fluorophenyl)-1-[5-[4-(3-morpholin-4-ylpropoxy)phenyl]-2-pyridinyl]butan-2-one |
| SMILES | O=C(CCc1cccc(F)c1)Cc1ccc(-c2ccc(OCCCN3CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C28H31FN2O3/c29-25-4-1-3-22(19-25)5-10-27(32)20-26-9-6-24(21-30-26)23-7-11-28(12-8-23)34-16-2-13-31-14-17-33-18-15-31/h1,3-4,6-9,11-12,19,21H,2,5,10,13-18,20H2 |
| InChIKey | ITRYNCMOMZMDEH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|