C31H38FN3O3 — CID 58190177
1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]butan-2-one (PubChem CID 58190177) has the molecular formula C31H38FN3O3 and a molecular weight of 519.66 g/mol. Its IUPAC name is 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]butan-2-one.
| Compound Name | 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]butan-2-one |
|---|---|
| PubChem CID | 58190177 |
| Molecular Formula | C31H38FN3O3 |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]butan-2-one |
| SMILES | CCOc1ccc(-c2ccc(CC(=O)CCc3cc(F)cc(OCCCN4CCN(C)CC4)c3)nc2)cc1 |
| InChI | InChI=1S/C31H38FN3O3/c1-3-37-30-11-7-25(8-12-30)26-6-9-28(33-23-26)22-29(36)10-5-24-19-27(32)21-31(20-24)38-18-4-13-35-16-14-34(2)15-17-35/h6-9,11-12,19-21,23H,3-5,10,13-18,22H2,1-2H3 |
| InChIKey | ULRCKXNDSNORKZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|