C29H32ClFN2O2 — CID 58190201
1-[5-(4-chlorophenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one (PubChem CID 58190201) has the molecular formula C29H32ClFN2O2 and a molecular weight of 495.04 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one.
| Compound Name | 1-[5-(4-chlorophenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one |
|---|---|
| PubChem CID | 58190201 |
| Molecular Formula | C29H32ClFN2O2 |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one |
| SMILES | O=C(CCc1cc(F)cc(OCCCN2CCCCC2)c1)Cc1ccc(-c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C29H32ClFN2O2/c30-25-9-6-23(7-10-25)24-8-11-27(32-21-24)20-28(34)12-5-22-17-26(31)19-29(18-22)35-16-4-15-33-13-2-1-3-14-33/h6-11,17-19,21H,1-5,12-16,20H2 |
| InChIKey | FLYHBKTWVAPXKV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|