C28H30F2N2O3 — CID 58190242
4-[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one (PubChem CID 58190242) has the molecular formula C28H30F2N2O3 and a molecular weight of 480.56 g/mol. Its IUPAC name is 4-[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one.
| Compound Name | 4-[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one |
|---|---|
| PubChem CID | 58190242 |
| Molecular Formula | C28H30F2N2O3 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 4-[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]-1-[5-(4-fluorophenyl)-2-pyridinyl]butan-2-one |
| SMILES | O=C(CCc1cc(F)cc(OCCCN2CCOCC2)c1)Cc1ccc(-c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C28H30F2N2O3/c29-24-6-3-22(4-7-24)23-5-8-26(31-20-23)19-27(33)9-2-21-16-25(30)18-28(17-21)35-13-1-10-32-11-14-34-15-12-32/h3-8,16-18,20H,1-2,9-15,19H2 |
| InChIKey | ZAYSSIMOYACJRO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|