C23H15ClN2O3S — CID 58191357
2-(4-chlorophenyl)-4-[2-oxo-2-(5-phenylpyrimidin-2-yl)ethyl]thiophene-3-carboxylic acid (PubChem CID 58191357) has the molecular formula C23H15ClN2O3S and a molecular weight of 434.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[2-oxo-2-(5-phenylpyrimidin-2-yl)ethyl]thiophene-3-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-4-[2-oxo-2-(5-phenylpyrimidin-2-yl)ethyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58191357 |
| Molecular Formula | C23H15ClN2O3S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[2-oxo-2-(5-phenylpyrimidin-2-yl)ethyl]thiophene-3-carboxylic acid |
| SMILES | O=C(Cc1csc(-c2ccc(Cl)cc2)c1C(=O)O)c1ncc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C23H15ClN2O3S/c24-18-8-6-15(7-9-18)21-20(23(28)29)16(13-30-21)10-19(27)22-25-11-17(12-26-22)14-4-2-1-3-5-14/h1-9,11-13H,10H2,(H,28,29) |
| InChIKey | QIIHEPJEMBPDBB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |