C21H13ClN2O3S — CID 58295460
4-(4-chlorophenyl)-2-(2-oxo-2-quinoxalin-2-ylethyl)thiophene-3-carboxylic acid (PubChem CID 58295460) has the molecular formula C21H13ClN2O3S and a molecular weight of 408.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(2-oxo-2-quinoxalin-2-ylethyl)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-(2-oxo-2-quinoxalin-2-ylethyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295460 |
| Molecular Formula | C21H13ClN2O3S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(2-oxo-2-quinoxalin-2-ylethyl)thiophene-3-carboxylic acid |
| SMILES | O=C(Cc1scc(-c2ccc(Cl)cc2)c1C(=O)O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H13ClN2O3S/c22-13-7-5-12(6-8-13)14-11-28-19(20(14)21(26)27)9-18(25)17-10-23-15-3-1-2-4-16(15)24-17/h1-8,10-11H,9H2,(H,26,27) |
| InChIKey | FJPPRJKOQDYGNV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |