C30H26O6S2 — CID 165002047
2-[8-(3-carboxy-4-phenylthiophen-2-yl)-2,7-dioxooctyl]-4-phenylthiophene-3-carboxylic acid (PubChem CID 165002047) has the molecular formula C30H26O6S2 and a molecular weight of 546.67 g/mol. Its IUPAC name is 2-[8-(3-carboxy-4-phenylthiophen-2-yl)-2,7-dioxooctyl]-4-phenylthiophene-3-carboxylic acid.
| Compound Name | 2-[8-(3-carboxy-4-phenylthiophen-2-yl)-2,7-dioxooctyl]-4-phenylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 165002047 |
| Molecular Formula | C30H26O6S2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 2-[8-(3-carboxy-4-phenylthiophen-2-yl)-2,7-dioxooctyl]-4-phenylthiophene-3-carboxylic acid |
| SMILES | O=C(CCCCC(=O)Cc1scc(-c2ccccc2)c1C(=O)O)Cc1scc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C30H26O6S2/c31-21(15-25-27(29(33)34)23(17-37-25)19-9-3-1-4-10-19)13-7-8-14-22(32)16-26-28(30(35)36)24(18-38-26)20-11-5-2-6-12-20/h1-6,9-12,17-18H,7-8,13-16H2,(H,33,34)(H,35,36) |
| InChIKey | FXUMGERROQYVMJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|