C18H13ClN2O3S — CID 58295624
4-(4-chlorophenyl)-2-[2-(6-methylpyridazin-3-yl)-2-oxoethyl]thiophene-3-carboxylic acid (PubChem CID 58295624) has the molecular formula C18H13ClN2O3S and a molecular weight of 372.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[2-(6-methylpyridazin-3-yl)-2-oxoethyl]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[2-(6-methylpyridazin-3-yl)-2-oxoethyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295624 |
| Molecular Formula | C18H13ClN2O3S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[2-(6-methylpyridazin-3-yl)-2-oxoethyl]thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(C(=O)Cc2scc(-c3ccc(Cl)cc3)c2C(=O)O)nn1 |
| InChI | InChI=1S/C18H13ClN2O3S/c1-10-2-7-14(21-20-10)15(22)8-16-17(18(23)24)13(9-25-16)11-3-5-12(19)6-4-11/h2-7,9H,8H2,1H3,(H,23,24) |
| InChIKey | GOTGDTYLXIRSKQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |