C21H15BrO3S — CID 58295296
4-(4-bromophenyl)-2-[(E)-2-oxo-4-phenylbut-3-enyl]thiophene-3-carboxylic acid (PubChem CID 58295296) has the molecular formula C21H15BrO3S and a molecular weight of 427.32 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[(E)-2-oxo-4-phenylbut-3-enyl]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)-2-[(E)-2-oxo-4-phenylbut-3-enyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295296 |
| Molecular Formula | C21H15BrO3S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 4-(4-bromophenyl)-2-[(E)-2-oxo-4-phenylbut-3-enyl]thiophene-3-carboxylic acid |
| SMILES | O=C(/C=C/c1ccccc1)Cc1scc(-c2ccc(Br)cc2)c1C(=O)O |
| InChI | InChI=1S/C21H15BrO3S/c22-16-9-7-15(8-10-16)18-13-26-19(20(18)21(24)25)12-17(23)11-6-14-4-2-1-3-5-14/h1-11,13H,12H2,(H,24,25)/b11-6+ |
| InChIKey | MHFIYFNXQQHHLG-IZZDOVSWSA-N |
| XLogP | 5.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|