C19H15NO4S — CID 58191486
4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-(4-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 58191486) has the molecular formula C19H15NO4S and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-(4-methylphenyl)thiophene-3-carboxylic acid.
| Compound Name | 4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-(4-methylphenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58191486 |
| Molecular Formula | C19H15NO4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 4-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-(4-methylphenyl)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2scc(NC(=O)/C=C/c3ccco3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C19H15NO4S/c1-12-4-6-13(7-5-12)18-17(19(22)23)15(11-25-18)20-16(21)9-8-14-3-2-10-24-14/h2-11H,1H3,(H,20,21)(H,22,23)/b9-8+ |
| InChIKey | FZEUATGMIAVIMV-CMDGGOBGSA-N |
| XLogP | 4.67 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|