C20H15BrClNO4S — CID 58191687
methyl 5-bromo-2-(4-chlorophenyl)-4-(phenylmethoxycarbonylamino)thiophene-3-carboxylate (PubChem CID 58191687) has the molecular formula C20H15BrClNO4S and a molecular weight of 480.77 g/mol. Its IUPAC name is methyl 5-bromo-2-(4-chlorophenyl)-4-(phenylmethoxycarbonylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-bromo-2-(4-chlorophenyl)-4-(phenylmethoxycarbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 58191687 |
| Molecular Formula | C20H15BrClNO4S |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 478.96 |
| IUPAC Name | methyl 5-bromo-2-(4-chlorophenyl)-4-(phenylmethoxycarbonylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)sc(Br)c1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H15BrClNO4S/c1-26-19(24)15-16(23-20(25)27-11-12-5-3-2-4-6-12)18(21)28-17(15)13-7-9-14(22)10-8-13/h2-10H,11H2,1H3,(H,23,25) |
| InChIKey | UKNCQVYYJJIHOY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |