C10H17N — CID 58193783
(2S)-4-methyl-2-(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridine (PubChem CID 58193783) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2S)-4-methyl-2-(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | (2S)-4-methyl-2-(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 58193783 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2S)-4-methyl-2-(2-methylprop-2-enyl)-1,2,3,6-tetrahydropyridine |
| SMILES | C=C(C)C[C@H]1CC(C)=CCN1 |
| InChI | InChI=1S/C10H17N/c1-8(2)6-10-7-9(3)4-5-11-10/h4,10-11H,1,5-7H2,2-3H3/t10-/m0/s1 |
| InChIKey | KYKWKMGLAUVRBL-JTQLQIEISA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|