C7H12N3+ — CID 58196212
6-methylidene-1-propan-2-yl-3,4-ditritio-1,3,5-triazin-1-ium (PubChem CID 58196212) has the molecular formula C7H12N3+ and a molecular weight of 142.21 g/mol. Its IUPAC name is 6-methylidene-1-propan-2-yl-3,4-ditritio-1,3,5-triazin-1-ium.
| Compound Name | 6-methylidene-1-propan-2-yl-3,4-ditritio-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 58196212 |
| Molecular Formula | C7H12N3+ |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 6-methylidene-1-propan-2-yl-3,4-ditritio-1,3,5-triazin-1-ium |
| SMILES | [3H]C1=NC(=C)[N+](C(C)C)=CN1[3H] |
| InChI | InChI=1S/C7H11N3/c1-6(2)10-5-8-4-9-7(10)3/h4-6H,3H2,1-2H3/p+1/i4T/hT |
| InChIKey | UDWUQVXLLMHWFW-XGVHJPNHSA-O |
| XLogP | 0.54 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|