C27H25FN4O — CID 58197004
CID 58197004 (PubChem CID 58197004) has the molecular formula C27H25FN4O and a molecular weight of 440.52 g/mol.
| Compound Name | CID 58197004 |
|---|---|
| PubChem CID | 58197004 |
| Molecular Formula | C27H25FN4O |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@@]2(N=C1N)c1cc(-c3cccnc3F)ccc1CC21CCc2ccccc2CC1 |
| InChI | InChI=1S/C27H25FN4O/c1-32-24(33)27(31-25(32)29)22-15-19(21-7-4-14-30-23(21)28)8-9-20(22)16-26(27)12-10-17-5-2-3-6-18(17)11-13-26/h2-9,14-15H,10-13,16H2,1H3,(H2,29,31)/t27-/m0/s1 |
| InChIKey | DAWZTCXCSMUINX-MHZLTWQESA-N |
| XLogP | 3.99 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|